CymitQuimica logo

CAS 1469924-27-3

:

Atglistatin

Description:
Atglistatin is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its potential applications in treating metabolic disorders. It is classified as a small molecule and functions primarily as an inhibitor of certain enzymes involved in lipid metabolism. The compound is designed to target specific pathways that regulate fat storage and energy expenditure, making it a candidate for addressing conditions such as obesity and dyslipidemia. Atglistatin's mechanism of action typically involves modulation of the activity of proteins associated with lipid metabolism, which can lead to alterations in fat accumulation and overall metabolic health. Additionally, its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion, are crucial for determining its efficacy and safety profile in clinical settings. As research continues, further studies are expected to elucidate its full therapeutic potential and any associated side effects. Overall, Atglistatin represents a promising avenue for developing new treatments for metabolic diseases.
Formula:C17H21N3O
InChI:InChI=1S/C17H21N3O/c1-19(2)16-10-8-13(9-11-16)14-6-5-7-15(12-14)18-17(21)20(3)4/h5-12H,1-4H3,(H,18,21)
InChI key:AWOPBSAJHCUSAS-UHFFFAOYSA-N
SMILES:CN(C)C1=CC=C(C=C1)C2=CC(=CC=C2)NC(=O)N(C)C
Found 11 products.