CymitQuimica logo

CAS 147009-33-4

:

3-(methylamino)-2,3,4,9-tetrahydro-1H-carbazole-6-carbonitrile

Description:
3-(Methylamino)-2,3,4,9-tetrahydro-1H-carbazole-6-carbonitrile is a chemical compound characterized by its complex structure, which includes a carbazole core—a bicyclic structure known for its aromatic properties. This compound features a methylamino group, which contributes to its potential biological activity, and a carbonitrile functional group that can influence its reactivity and solubility. The presence of the tetrahydro moiety indicates that the compound has undergone partial hydrogenation, resulting in a saturated ring system that may affect its pharmacokinetic properties. Typically, compounds of this nature are investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The specific arrangement of atoms and functional groups in this molecule may confer unique properties, such as binding affinity to certain receptors or enzymes, making it a subject of interest in drug discovery and development.
Formula:C14H15N3
InChI:InChI=1/C14H15N3/c1-16-10-3-5-14-12(7-10)11-6-9(8-15)2-4-13(11)17-14/h2,4,6,10,16-17H,3,5,7H2,1H3
InChI key:WPDCBQPOJXEMKM-UHFFFAOYSA-N
SMILES:CNC1CCc2c(C1)c1cc(ccc1[nH]2)C#N
Found 3 products.