CymitQuimica logo

CAS 14719-21-2

:

Acetamide, 2,2,2-trifluoro-N-2-propynyl-

Description:
Acetamide, 2,2,2-trifluoro-N-2-propynyl- (CAS 14719-21-2) is an organic compound characterized by the presence of a trifluoromethyl group and a propynyl substituent attached to the nitrogen of the acetamide functional group. This compound typically exhibits properties associated with both amides and fluorinated compounds, such as increased polarity and potential for hydrogen bonding due to the amide functional group. The trifluoromethyl group contributes to its unique reactivity and stability, often enhancing lipophilicity and altering the compound's interaction with biological systems. The presence of the propynyl group may also impart distinct chemical reactivity, making it useful in various synthetic applications. Acetamides are generally known for their low volatility and moderate solubility in polar solvents, which can be influenced by the fluorinated substituents. Overall, this compound's characteristics make it of interest in fields such as medicinal chemistry and materials science, where fluorinated compounds often exhibit enhanced properties compared to their non-fluorinated counterparts.
Formula:C5H4F3NO
InChI:InChI=1S/C5H4F3NO/c1-2-3-9-4(10)5(6,7)8/h1H,3H2,(H,9,10)
InChI key:GAUSMJHDHCSZOX-UHFFFAOYSA-N
SMILES:C#CCNC(=O)C(F)(F)F
Found 6 products.