CymitQuimica logo

CAS 14735-70-7

:

(1S,2S,5R,6R)-3-azatricyclo[4.2.1.0~2,5~]non-7-en-4-one

Description:
The chemical substance known as (1S,2S,5R,6R)-3-azatricyclo[4.2.1.0^2,5]non-7-en-4-one, with the CAS number 14735-70-7, is a bicyclic compound featuring a nitrogen atom within its ring structure, classifying it as an azabicyclic compound. This compound exhibits a unique tricyclic framework, which contributes to its distinct stereochemistry, as indicated by its specific stereochemical descriptors (1S,2S,5R,6R). The presence of a double bond and a ketone functional group (4-one) suggests that it may participate in various chemical reactions, including electrophilic additions and reductions. Its structural complexity may influence its biological activity, making it of interest in medicinal chemistry and drug design. Additionally, the stereochemistry can significantly affect the compound's interactions with biological targets, potentially leading to varied pharmacological effects. Overall, this compound's unique structure and functional groups position it as a subject of interest for further research in organic synthesis and potential therapeutic applications.
Formula:C8H9NO
InChI:InChI=1/C8H9NO/c10-8-6-4-1-2-5(3-4)7(6)9-8/h1-2,4-7H,3H2,(H,9,10)/t4-,5+,6+,7-/m0/s1
InChI key:WBZQHVKGKQXWMW-UHFFFAOYSA-N
SMILES:C1C2C=CC1C3C2C(=O)N3
Synonyms:
  • (1S,2S,5R,6R)-3-Azatricyclo[4.2.1.02,5
  • 3-Azatricyclo[4.2.1.02,5
Found 3 products.