CAS 147441-56-3
:Cyclohexanol,2-[(dimethyloxidoamino)methyl]-1-(3-methoxyphenyl)-, (1R,2R)-rel-
Description:
Cyclohexanol, 2-[(dimethyloxidoamino)methyl]-1-(3-methoxyphenyl)-, (1R,2R)-rel- (CAS 147441-56-3) is a chemical compound characterized by its cyclohexanol backbone, which features a hydroxyl group (-OH) attached to a cyclohexane ring. The compound also contains a dimethyloxidoamino group, indicating the presence of nitrogen and oxygen functionalities that may contribute to its reactivity and potential biological activity. Additionally, the presence of a methoxyphenyl group suggests aromatic characteristics, which can influence the compound's solubility and interaction with other molecules. The (1R,2R)-rel- designation indicates specific stereochemistry, which can affect the compound's pharmacological properties and interactions in biological systems. Cyclohexanol derivatives are often studied for their applications in pharmaceuticals, agrochemicals, and as solvents. The unique combination of functional groups in this compound may impart specific properties, such as increased polarity or the ability to form hydrogen bonds, which can be critical for its behavior in various chemical environments.
Formula:C16H25NO3
InChI:InChI=1S/C16H25NO3/c1-17(2,19)12-14-7-4-5-10-16(14,18)13-8-6-9-15(11-13)20-3/h6,8-9,11,14,18H,4-5,7,10,12H2,1-3H3/t14-,16+/m0/s1
InChI key:HBXKSXMNNGHBEA-GOEBONIOSA-N
SMILES:C[N+](C)(C[C@@H]1CCCC[C@]1(C2=CC(=CC=C2)OC)O)[O-]
Synonyms:- Cyclohexanol,2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)-, N-oxide, cis-(?à)-
- Cyclohexanol,2-[(dimethyloxidoamino)methyl]-1-(3-methoxyphenyl)-, cis-
- Rwj 38705
- TramadolN-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 7 products.
Tramadol N-Oxide (1 mg/ml in Acetonitrile)
CAS:Controlled ProductFormula:C16H25NO3Color and Shape:Single SolutionMolecular weight:279.37Tramadol N-oxide
CAS:Tramadol N-oxide (T-N-O) (RWJ 38705) is an analgesic. In animal models such as the mouse abdominal constriction test, 48°C and 55°C hot plate tests, and the tail-flick assay, Tramadol N-oxide demonstrates a dose-dependent and prolonged analgesic effect. Its affinity for opioid μ receptors (Ki = 38.5 μM) and δ or κ receptors (Ki > 100 μM) is negligible. Tramadol N-oxide is used for researching analgesic effects.Formula:C16H25NO3Molecular weight:279.38





