CAS 14790-42-2
:4-chloro-2-phenylpyrimidine
Description:
4-Chloro-2-phenylpyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a chlorine atom at the 4-position and a phenyl group at the 2-position. This compound typically appears as a solid and is known for its role in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure contributes to its potential biological activity, including antimicrobial and antiviral properties. The presence of the chlorine atom enhances the compound's lipophilicity, which can influence its absorption and distribution in biological systems. Additionally, 4-chloro-2-phenylpyrimidine may participate in various chemical reactions, such as nucleophilic substitutions, due to the electrophilic nature of the chlorine atom. Its solubility characteristics can vary depending on the solvent, and it is generally stable under standard laboratory conditions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H7ClN2
InChI:InChI=1/C10H7ClN2/c11-9-6-7-12-10(13-9)8-4-2-1-3-5-8/h1-7H
SMILES:c1ccc(cc1)c1nccc(Cl)n1
Synonyms:- Pyrimidine, 4-Chloro-2-Phenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Pyrimidine, 4-chloro-2-phenyl-
CAS:Formula:C10H7ClN2Purity:95%Color and Shape:SolidMolecular weight:190.62904-Chloro-2-phenylpyrimidine
CAS:4-Chloro-2-phenylpyrimidineFormula:C10H7ClN2Purity:98%Molecular weight:190.634-Chloro-2-phenylpyrimidine
CAS:4-Chloro-2-phenylpyrimidineFormula:C10H7ClN2Purity:95%Molecular weight:190.634-Chloro-2-phenylpyrimidine
CAS:Formula:C10H7ClN2Purity:98%Color and Shape:Solid, Yellow powderMolecular weight:190.634-Chloro-2-phenyl-pyrimidine
CAS:4-Chloro-2-phenyl-pyrimidine is a synthetic compound that has been shown to be effective against bacterial strains resistant to other antibiotics. 4CPP is an amide with a chloro group at the 2 position and a pyridine ring at the 4 position. It has been shown to inhibit bacteria by binding to the molecule and preventing its function. This binding causes cell death by inhibiting protein synthesis and DNA replication. 4CPP also undergoes phototransformation when exposed to ultraviolet light, which may lead to increased efficacy of this drug in vivo.4CPP is synthesized from 2,4-dichloropyrimidine, which reacts with an amine in acidic conditions. The substituent effects on the aromatic rings are important for determining reactivity of this molecule.END>>Formula:C10H7ClN2Purity:Min. 95%Molecular weight:190.63 g/mol




