CAS 147958-06-3
:seminalplasmin, Lys(13)-
Description:
Seminalplasmin, specifically the variant Lys(13)-, is a peptide derived from seminal plasma, which plays a role in reproductive biology. This substance is characterized by its antimicrobial properties, contributing to the protection of sperm and the female reproductive tract from infections. The modification at the 13th position, where lysine is introduced, may influence its biological activity and stability. Seminalplasmin is known for its ability to bind to various biological molecules, which can affect its function in the reproductive system. It is typically studied in the context of male fertility and the immune response within the reproductive tract. The CAS number 147958-06-3 uniquely identifies this specific peptide variant, facilitating its recognition in scientific literature and databases. Overall, seminalplasmin, Lys(13)-, is an important biomolecule with implications in reproductive health and immunology.
Formula:C76H123N17O16
InChI:InChI=1/C76H123N17O16/c1-10-46(8)63(75(108)82-41-62(96)97)92-73(106)60(39-49-40-81-51-26-15-14-25-50(49)51)89-67(100)54(28-17-20-32-78)85-74(107)61(42-94)91-71(104)58(37-45(6)7)88-72(105)59(38-48-23-12-11-13-24-48)90-76(109)64(47(9)95)93-68(101)55(29-18-21-33-79)84-69(102)56(35-43(2)3)87-70(103)57(36-44(4)5)86-66(99)53(27-16-19-31-77)83-65(98)52-30-22-34-80-52/h11-15,23-26,40,43-47,52-61,63-64,80-81,94-95H,10,16-22,27-39,41-42,77-79H2,1-9H3,(H,82,108)(H,83,98)(H,84,102)(H,85,107)(H,86,99)(H,87,103)(H,88,105)(H,89,100)(H,90,109)(H,91,104)(H,92,106)(H,93,101)(H,96,97)/t46-,47+,52-,53-,54-,55-,56-,57-,58-,59-,60-,61-,63-,64-/m0/s1
Synonyms:- 13-Lys-seminalplasmin
- Seminalplasmin, lysyl(13)-
- Spfk-res
- Glycine, L-prolyl-L-lysyl-L-leucyl-L-leucyl-L-lysyl-L-threonyl-L-phenylalanyl-L-leucyl-L-seryl-L-lysyl-L-tryptophyl-L-isoleucyl-
- L-prolyl-L-lysyl-L-leucyl-L-leucyl-L-lysyl-L-threonyl-L-phenylalanyl-L-leucyl-L-seryl-L-lysyl-L-tryptophyl-L-isoleucylglycine
- Seminalplasmin, lys(13)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Glycine, L-prolyl-L-lysyl-L-leucyl-L-leucyl-L-lysyl-L-threonyl-L-phenylalanyl-L-leucyl-L-seryl-L-lysyl-L-tryptophyl-L-isoleucyl-
CAS:Formula:C76H123N17O16Molecular weight:1530.8941Seminalplasmin Fragment (SPF) Analog
CAS:<p>Seminalplasmin Fragment (SPF) is a potent antibacterial agent that has been shown to inhibit the growth of Leishmania. It binds to the target cells, forming a covalent bond with the surface of the cell membrane. The SPF analog H-Pro-Lys-Leu-Leu-Lys-Thr-Phe-Leu-Ser-Lys-Trp-Ile-Gly-OH has been shown to have an increased antimicrobial spectrum due to its increased stability in acidic environments. This analog is also active against Gram positive bacteria and can be synthesized using cyclic peptide chemistry. This drug has been shown to have hemolytic activity, meaning that it inhibits red blood cell lysis by binding to phospholipids on the surface of red blood cells.</p>Formula:C76H123N17O16Purity:Min. 95%Molecular weight:1,530.89 g/mol

