CAS 148016-81-3
:Doripenem
Description:
Doripenem is a broad-spectrum carbapenem antibiotic used primarily for the treatment of serious infections caused by multidrug-resistant bacteria. It exhibits a high degree of stability against various beta-lactamases, making it effective against a wide range of Gram-positive and Gram-negative pathogens, including Pseudomonas aeruginosa. The chemical structure of doripenem features a beta-lactam ring, which is essential for its antibacterial activity, and a thiazole ring that contributes to its pharmacological properties. Doripenem is typically administered intravenously and is known for its favorable pharmacokinetic profile, allowing for effective tissue penetration. Its spectrum of activity includes complicated intra-abdominal infections, complicated urinary tract infections, and hospital-acquired pneumonia. However, like other antibiotics, doripenem may lead to adverse effects, including gastrointestinal disturbances and potential allergic reactions. Its use is generally reserved for cases where other antibiotics are ineffective, emphasizing the importance of appropriate antibiotic stewardship to combat resistance.
Formula:C15H24N4O6S2
InChI:InChI=1S/C15H24N4O6S2/c1-6-11-10(7(2)20)14(21)19(11)12(15(22)23)13(6)26-9-3-8(17-5-9)4-18-27(16,24)25/h6-11,17-18,20H,3-5H2,1-2H3,(H,22,23)(H2,16,24,25)/t6-,7-,8+,9+,10-,11-/m1/s1
InChI key:InChIKey=AVAACINZEOAHHE-VFZPANTDSA-N
SMILES:C(O)(=O)C=1N2[C@@]([C@@]([C@@H](C)O)(C2=O)[H])([C@@H](C)C1S[C@H]3C[C@@H](CNS(N)(=O)=O)NC3)[H]
Synonyms:- (+)-(4R,5S,6S)-6-[(1R)-1-Hydro-Xyethyl]-4-Methyl-7-Oxo-3-[[(3S,5S)-5-[(Sulfamoylamino)-Methyl]-3-Pyrrolidinyl]Thio]-1-Azabicyclo[3.2.0]Hept-2-Ene-2-Carboxylic Acid
- (4R,5S,6S)-3-[[(3S,5S)-5-[[(Aminosulfonyl)amino]methyl]-3-pyrrolidinyl]thio]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid
- (4R,5S,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-({(3S,5S)-5-[(sulfamoylamino)methyl]pyrrolidin-3-yl}sulfanyl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid
- 1-Azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid, 3-[[(3S,5S)-5-[[(aminosulfonyl)amino]methyl]-3-pyrrolidinyl]thio]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-, (4R,5S,6S)-
- 1-Azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid, 3-[[5-[[(aminosulfonyl)amino]methyl]-3-pyrrolidinyl]thio]-6-(1-hydroxyethyl)-4-methyl-7-oxo-, [4R-[3(3S*,5S*),4α,5β,6β(R*)]]-
- Doribax
- Doripenem Sterile
- Finibax
- S 4661
- Doripenem
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Doripenem-d4 Sodium Salt
CAS:Formula:C15H19D4N4O6S2·NaColor and Shape:White To Off-White SolidMolecular weight:423.52 22.99Doripenem
CAS:Formula:C15H24N4O6S2·xH2OPurity:(anhydrous basis) ≥ 98.0%Color and Shape:White to light-yellow or beige powderMolecular weight:420.50 (anhydrous)Doripenem
CAS:Doripenem is a new parenteral carbapenem antibiotic with broad-spectrum activity against gram-negative and gram-positive pathogens.Formula:C15H24N4O6S2Purity:99.16% - 99.79%Color and Shape:White To Off-White PowderMolecular weight:420.504Doripenem
CAS:Doripenem is a carbapenem antibiotic with action on bacterial cell wall synthesis and is used for treating complicated bacterial infections like intra-abdominal infections and urinary tract infections.
Formula:C15H24N4O6S2Purity:Min. 95%Color and Shape:White PowderMolecular weight:420.51 g/mol
