CAS 1482-82-2
:Dibenzyldiselenide
Description:
Dibenzyldiselenide is an organoselenium compound characterized by the presence of two benzyl groups attached to a diselenide functional group. Its molecular structure consists of two selenium atoms bonded to each other, with each selenium atom further bonded to a benzyl group, which is a phenyl group (C6H5) attached to a methylene group (–CH2–). This compound typically appears as a yellow to orange solid and is known for its relatively low solubility in water but higher solubility in organic solvents. Dibenzyldiselenide exhibits interesting chemical properties, including potential antioxidant activity and the ability to participate in redox reactions. It has been studied for its biological activities, including potential applications in medicinal chemistry and as a precursor in the synthesis of other selenium-containing compounds. Safety considerations should be taken into account when handling dibenzyldiselenide, as selenium compounds can be toxic in certain forms and concentrations. Overall, dibenzyldiselenide is a notable compound in the field of organoselenium chemistry with various implications in research and applications.
Formula:C14H14Se2
InChI:InChI=1/C14H14Se2/c1-3-7-13(8-4-1)11-15-16-12-14-9-5-2-6-10-14/h1-10H,11-12H2
SMILES:c1ccc(cc1)C[Se][Se]Cc1ccccc1
Synonyms:- Dibenzyldiselane
- Diselane, 1,2-Bis(Phenylmethyl)-
- Diselane, Bis(Phenylmethyl)-
- Diselenide, bis(phenylmethyl)
- Dibenzyl diselenide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Dibenzyl Diselenide
CAS:Formula:C14H14Se2Purity:>95.0%(T)Color and Shape:Light yellow to Yellow to Orange powder to crystalineMolecular weight:340.19Dibenzyl diselenide, 95%
CAS:Dibenzyl diselenide is used as a source of the PhSe unit in organic synthesis. It is also used to introduce PhSe groups by reaction with a variety of nucleophilic, including enolates, enol silyl ethers, Grignard reagents, organolithium reagents, alkenes and amines. This Thermo Scientific Chemicals bFormula:C14H14Se2Purity:95%Color and Shape:Yellow to brown, PowderMolecular weight:340.21Diselenide, bis(phenylmethyl)
CAS:Formula:C14H14Se2Purity:95%Color and Shape:SolidMolecular weight:340.1810





