CymitQuimica logo

CAS 148254-33-5

:

2-Chloro-4-fluoro-5-iodophenol

Description:
2-Chloro-4-fluoro-5-iodophenol is an organic compound characterized by the presence of a phenolic hydroxyl group and multiple halogen substituents on the aromatic ring. Specifically, it features chlorine, fluorine, and iodine atoms attached to the benzene ring at the 2, 4, and 5 positions, respectively. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is known for its potential applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. The presence of halogens can influence its reactivity, making it a useful building block in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's unique combination of halogen atoms may impart specific biological activities, making it of interest in medicinal chemistry. Safety precautions should be observed when handling this substance, as halogenated compounds can pose health risks and environmental concerns.
Formula:C6H3ClFIO
InChI:InChI=1S/C6H3ClFIO/c7-3-1-4(8)5(9)2-6(3)10/h1-2,10H
InChI key:InChIKey=UVAMUYYGGYKGKG-UHFFFAOYSA-N
SMILES:ClC1=C(O)C=C(I)C(F)=C1
Synonyms:
  • Phenol, 2-chloro-4-fluoro-5-iodo-
  • 2-Chloro-4-fluoro-5-iodophenol
Found 2 products.