CAS 1483-28-9
:2,5-Dimethoxybenzenesulfonyl chloride
Description:
2,5-Dimethoxybenzenesulfonyl chloride, with the CAS number 1483-28-9, is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a dimethoxy-substituted benzene ring. This compound typically appears as a white to light yellow solid and is known for its reactivity, particularly in nucleophilic substitution reactions due to the electrophilic nature of the sulfonyl chloride group. The dimethoxy groups enhance its solubility in organic solvents and can influence its reactivity and stability. It is commonly used as a reagent in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl derivatives. Safety precautions are necessary when handling this compound, as it can be corrosive and may release toxic gases upon contact with moisture or water. Proper storage in a cool, dry place, away from incompatible materials, is essential to maintain its stability and prevent degradation.
Formula:C8H9ClO4S
InChI:InChI=1/C8H9ClO4S/c1-12-6-3-4-7(13-2)8(5-6)14(9,10)11/h3-5H,1-2H3
SMILES:COc1ccc(c(c1)S(=O)(=O)Cl)OC
Synonyms:- 2,5-Dimethoxybenzene-1-sulfonyl chloride
- 2,5-Dimethoxybenzenesulphonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenesulfonyl chloride, 2,5-dimethoxy-
CAS:Formula:C8H9ClO4SPurity:97%Color and Shape:SolidMolecular weight:236.67272,5-Dimethoxybenzenesulphonyl chloride
CAS:2,5-Dimethoxybenzenesulphonyl chlorideFormula:C8H9ClO4SPurity:98%Color and Shape: white to yellow to gray powderMolecular weight:236.67266g/mol2,5-Dimethoxybenzenesulfonyl chloride
CAS:Formula:C8H9ClO4SPurity:97%Color and Shape:SolidMolecular weight:236.672,5-Dimethoxybenzenesulfonyl chloride
CAS:2,5-Dimethoxybenzenesulfonyl chloride is a potent inhibitor of the enzyme acetylcholinesterase. It is used to prepare calibration standards for use in analytical chemistry and as an intermediate in the synthesis of other compounds. 2,5-Dimethoxybenzenesulfonyl chloride inhibits the production of neurotransmitter acetylcholine by preventing acetylcholinesterase from breaking down acetylcholine. This inhibition leads to an increase in the concentration of acetylcholine at synaptic junctions, which causes paralysis and death. This compound also has anticoagulant properties and can be used orally as a rodenticide.
Formula:C8H9ClO4SPurity:Min. 95%Molecular weight:236.67 g/mol



