CAS 1483-28-9

2,5-Dimethoxybenzenesulfonyl chloride

Description:

2,5-Dimethoxybenzenesulfonyl chloride, with the CAS number 1483-28-9, is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a dimethoxy-substituted benzene ring. This compound typically appears as a white to light yellow solid and is known for its reactivity, particularly in nucleophilic substitution reactions due to the electrophilic nature of the sulfonyl chloride group. The dimethoxy groups enhance its solubility in organic solvents and can influence its reactivity and stability. It is commonly used as a reagent in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl derivatives. Safety precautions are necessary when handling this compound, as it can be corrosive and may release toxic gases upon contact with moisture or water. Proper storage in a cool, dry place, away from incompatible materials, is essential to maintain its stability and prevent degradation.

Formula: C₈H₉ClO₄S

InChI: InChI=1/C8H9ClO4S/c1-12-6-3-4-7(13-2)8(5-6)14(9,10)11/h3-5H,1-2H3

SMILES: COc1ccc(c(c1)S(=O)(=O)Cl)OC

Synonyms:

• 2,5-Dimethoxybenzene-1-sulfonyl chloride
• 2,5-Dimethoxybenzenesulphonyl chloride

2,5-Dimethoxybenzenesulfonyl chloride

CAS: 1483-28-9

2,5-Dimethoxybenzenesulfonyl chloride

Formula: C₈H₉ClO₄S

Purity: 98%

Molecular weight: 236.67

Ref: IN-DG6477

2,5-Dimethoxybenzenesulphonyl chloride

CAS: 1483-28-9

2,5-Dimethoxybenzenesulphonyl chloride

Formula: C₈H₉ClO₄S

Purity: >98%

Color and Shape: Solid

Molecular weight: 236.67266

Ref: 54-OR5556

Benzenesulfonyl chloride, 2,5-dimethoxy-

CAS: 1483-28-9

Formula: C₈H₉ClO₄S

Purity: 98%

Color and Shape: Solid

Molecular weight: 236.6727

Ref: IN-DA001FL8

2,5-Dimethoxybenzenesulfonyl chloride

CAS: 1483-28-9

Formula: C₈H₉ClO₄S

Purity: 97%

Color and Shape: Solid

Molecular weight: 236.67

Ref: 10-F008034

2,5-Dimethoxybenzenesulfonyl chloride

CAS: 1483-28-9

2,5-Dimethoxybenzenesulfonyl chloride is a potent inhibitor of the enzyme acetylcholinesterase. It is used to prepare calibration standards for use in analytical chemistry and as an intermediate in the synthesis of other compounds. 2,5-Dimethoxybenzenesulfonyl chloride inhibits the production of neurotransmitter acetylcholine by preventing acetylcholinesterase from breaking down acetylcholine. This inhibition leads to an increase in the concentration of acetylcholine at synaptic junctions, which causes paralysis and death. This compound also has anticoagulant properties and can be used orally as a rodenticide.

Formula: C₈H₉ClO₄S

Purity: Min. 95%

Molecular weight: 236.67 g/mol

Ref: 3D-FD112832