CymitQuimica logo

CAS 148546-99-0

:

3-(4-Methylpiperazin-1-yl)aniline

Description:
3-(4-Methylpiperazin-1-yl)aniline, with the CAS number 148546-99-0, is an organic compound characterized by its aniline structure substituted with a 4-methylpiperazine group. This compound features a piperazine ring, which is a six-membered cyclic amine, contributing to its basicity and potential for forming hydrogen bonds. The presence of the methyl group on the piperazine enhances its lipophilicity, which can influence its solubility and permeability in biological systems. The aniline portion of the molecule provides it with aromatic characteristics, which can affect its reactivity and interaction with other chemical species. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various conditions. Its properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. Overall, 3-(4-Methylpiperazin-1-yl)aniline is a versatile compound with potential applications in medicinal chemistry and related fields.
Formula:C11H17N3
InChI:InChI=1S/C11H17N3/c1-13-5-7-14(8-6-13)11-4-2-3-10(12)9-11/h2-4,9H,5-8,12H2,1H3
InChI key:RJGHJWKQCJAJEP-UHFFFAOYSA-N
SMILES:CN1CCN(CC1)C2=CC=CC(=C2)N
Synonyms:
  • Akos Bb-8951
  • Benzenamine, 3-(4-methyl-1-piperazinyl)- (9CI)
  • 3-(4-Methylpiperazin-1-yl)aniline 97%
Found 4 products.