CymitQuimica logo

CAS 1488-02-4

:

3-phenylpyrrolidin-3-ol hydrochloride (1:1)

Description:
3-Phenylpyrrolidin-3-ol hydrochloride (1:1), with the CAS number 1488-02-4, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a phenyl group attached to the pyrrolidine ring contributes to its aromatic properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, potentially acting as a central nervous system agent, although specific biological activities can vary based on its stereochemistry and formulation. Its molecular structure allows for interactions with various biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Proper characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry is essential for confirming its identity and purity in research and industrial applications.
Formula:C10H14ClNO
InChI:InChI=1/C10H13NO.ClH/c12-10(6-7-11-8-10)9-4-2-1-3-5-9;/h1-5,11-12H,6-8H2;1H
InChI key:TXWWLCQBZZBGQW-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C1(CCNC1)O.Cl
Synonyms:
  • 3-Pyrrolidinol, 3-Phenyl-, Hydrochloride (1:1)
  • 3-Phenyl-3-pyrrolidinol HCl
Found 3 products.