CAS 14901-63-4
:Phosphite
Description:
Phosphite, specifically referring to the compound with the CAS number 14901-63-4, is a chemical substance that typically exists as a salt or ester of phosphorous acid. It contains the phosphite ion (PO3^3−), which is characterized by a phosphorus atom bonded to three oxygen atoms, with one of the oxygen atoms typically involved in a double bond. Phosphites are known for their role as reducing agents and are often used in various applications, including agriculture as fungicides and in the production of certain polymers. They can also serve as intermediates in organic synthesis. In terms of physical properties, phosphites are generally soluble in water and exhibit varying degrees of stability depending on their specific chemical structure and environment. Safety considerations are important, as some phosphite compounds can be toxic or harmful if ingested or inhaled. Overall, phosphites are versatile compounds with significant utility in both industrial and agricultural contexts.
Formula:O3P
InChI:InChI=1/O3P/c1-4(2)3/q-3
InChI key:InChIKey=AQSJGOWTSHOLKH-UHFFFAOYSA-N
SMILES:P([O-])([O-])[O-]
Synonyms:- Orthophosphite
- Phosphite
- Orthophosphite
- Phosphorous acid, ion(3-)
- Phosphite ions
- Alendronate EP Impurity C Q: What is the CAS Number of
- trioxidophosphane
- Alendronate EP Impurity CQ: What is
- Alendronate EP Impurity C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
