CAS 14917-41-0
:2',4',6',3,4-PENTAHYDROXYCHALCONE
Description:
2',4',6',3,4-Pentahydroxychalcone is a flavonoid compound characterized by its multiple hydroxyl (-OH) groups, which contribute to its solubility and reactivity. This compound features a chalcone backbone, consisting of two aromatic rings connected by a three-carbon α,β-unsaturated carbonyl system. The presence of five hydroxyl groups enhances its antioxidant properties, making it of interest in various biological and pharmaceutical applications. It is known for its potential health benefits, including anti-inflammatory and antimicrobial activities. The compound's structure allows for various interactions with biological molecules, which may influence its efficacy in therapeutic contexts. Additionally, its solubility in polar solvents is attributed to the hydroxyl groups, facilitating its use in formulations. As a naturally occurring compound, it can be found in certain plants and is studied for its role in traditional medicine and potential applications in nutraceuticals. Overall, 2',4',6',3,4-Pentahydroxychalcone represents a significant area of interest in the field of natural products and medicinal chemistry.
Formula:C15H12O6
InChI:InChI=1/C15H12O6/c16-9-6-13(20)15(14(21)7-9)11(18)4-2-8-1-3-10(17)12(19)5-8/h1-7,16-17,19-21H/b4-2+
Synonyms:- Eriodictyol Chalcone
- 3,4,2',4',6'-Pentahydroxychalcone
- Pentahydroxychalcone,2',4',6',3,4-
- Pentahydroxychalcone,2',4',6',3,4-(Sh)
- 3,4,2',4',6'-Pentahydroxychalcone With Hplc
- (2E)-3-(3,4-dihydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Eriodictyol chalcone
CAS:Eriodictyol chalcone analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C15H12O6Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:288.27(E)-3-(3,4-Dihydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one
CAS:Formula:C15H12O6Purity:95%Molecular weight:288.2522Eriodictyol chalcone
CAS:Eriodictyol chalcone is a natural product exhibiting inhibitory activity against 17β-HSD, suitable for biochemical experiments and drug synthesis research.Formula:C15H12O6Purity:99.82%Color and Shape:SolidMolecular weight:288.252',3,4,4',6'-Pentahydroxychalcone
CAS:2',3,4,4',6'-Pentahydroxychalcone is a polyphenolic compound, which is a type of flavonoid known for its extensive hydroxylation. This compound is primarily derived from natural plant sources, often found in fruits, vegetables, and some specific botanicals commonly used in traditional medicine. The compound's structure, featuring multiple hydroxyl groups, contributes to its notable biochemical activitiesFormula:C15H12O6Purity:Min. 95%Molecular weight:288.25 g/mol





