CAS 149520-74-1
:3-aminocyclohexanone
Description:
3-Aminocyclohexanone is a cyclic organic compound characterized by the presence of both an amine and a ketone functional group. It features a six-membered cyclohexane ring with an amino group (-NH2) attached to the third carbon and a carbonyl group (C=O) at the first position. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is soluble in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The compound exhibits basic properties due to the amine functionality, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. 3-Aminocyclohexanone can be used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals and agrochemicals. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Proper storage and handling protocols are essential to ensure safety in laboratory and industrial settings.
Formula:C6H11NO
InChI:InChI=1/C6H11NO/c7-5-2-1-3-6(8)4-5/h5H,1-4,7H2
SMILES:C1CC(CC(=O)C1)N
Synonyms:- Cyclohexanone, 3-Amino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
