CymitQuimica logo

CAS 149554-06-3

:

4-(4'-Cyanophenyl)piperidine

Description:
4-(4'-Cyanophenyl)piperidine, identified by its CAS number 149554-06-3, is an organic compound characterized by a piperidine ring substituted with a cyanophenyl group. The piperidine moiety consists of a six-membered ring containing one nitrogen atom, which contributes to its basicity and potential as a ligand in various chemical reactions. The presence of the cyanophenyl group introduces a cyano functional group (-CN) attached to a phenyl ring, which can enhance the compound's electronic properties and reactivity. This compound is typically studied in the context of medicinal chemistry and drug development due to its structural features that may influence biological activity. It may exhibit properties such as lipophilicity, which can affect its absorption and distribution in biological systems. Additionally, the compound's potential applications could include roles in the synthesis of pharmaceuticals or as intermediates in organic synthesis. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C12H14N2
InChI:InChI=1/C12H14N2/c13-9-10-1-3-11(4-2-10)12-5-7-14-8-6-12/h1-4,12,14H,5-8H2
InChI key:WIAZPDPJRACUDP-UHFFFAOYSA-N
SMILES:c1cc(ccc1C#N)C1CCNCC1
Synonyms:
  • 4-Piperidin-4-Ylbenzonitrile
Found 5 products.