CymitQuimica logo

CAS 14957-98-3

:

Phenol, 2-chloro-4-nitro-, dihydrogen phosphate (ester)

Description:
Phenol, 2-chloro-4-nitro-, dihydrogen phosphate (ester), with the CAS number 14957-98-3, is a chemical compound that features a phenolic structure substituted with both a chloro and a nitro group, alongside a dihydrogen phosphate ester functional group. This compound is characterized by its aromatic ring, which contributes to its stability and reactivity. The presence of the chloro group typically enhances electrophilic substitution reactions, while the nitro group can influence the compound's electronic properties, making it more reactive towards nucleophiles. The dihydrogen phosphate ester moiety indicates that the compound can participate in various biochemical processes, potentially acting as a phosphate donor. This compound may exhibit solubility in polar solvents due to the presence of the phosphate group, while its aromatic nature may confer some hydrophobic characteristics. Overall, its unique combination of functional groups suggests potential applications in organic synthesis, pharmaceuticals, or as a biochemical reagent, although specific applications would depend on further research into its properties and behavior in various chemical environments.
Formula:C6H5ClNO6P
InChI:InChI=1S/C6H5ClNO6P/c7-5-3-4(8(9)10)1-2-6(5)14-15(11,12)13/h1-3H,(H2,11,12,13)
InChI key:IKQSNKKSCOCCOD-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1[N+](=O)[O-])Cl)OP(=O)(O)O
Found 2 products.