CAS 149759-96-6
:FTase inhibitor I
Description:
FTase inhibitor I, also known by its CAS number 149759-96-6, is a chemical compound that functions primarily as an inhibitor of farnesyltransferase, an enzyme involved in the post-translational modification of proteins. This modification is crucial for the proper functioning of various proteins, particularly those involved in cell signaling and growth. The inhibition of farnesyltransferase can disrupt the farnesylation process, thereby affecting the activity of oncogenic proteins, making FTase inhibitor I of interest in cancer research and therapeutic development. The compound typically exhibits characteristics such as a specific molecular structure that allows it to bind to the active site of the enzyme, thereby preventing substrate access. Its efficacy and specificity can vary based on structural modifications and the presence of other cellular factors. Additionally, FTase inhibitor I may have implications in the study of other diseases where farnesylation plays a role, highlighting its potential as a valuable tool in pharmacological research.
Formula:C22H38N4O3S2
InChI:InChI=1S/C22H38N4O3S2/c1-15(2)20(24-12-17(23)14-30)13-25-19(11-16-7-5-4-6-8-16)21(27)26-18(22(28)29)9-10-31-3/h4-8,15,17-20,24-25,30H,9-14,23H2,1-3H3,(H,26,27)(H,28,29)/t17-,18+,19+,20-/m1/s1
InChI key:InChIKey=QISLMXIYRQCLIR-FUMNGEBKSA-N
SMILES:[C@H](CC1=CC=CC=C1)(C(N[C@@H](CCSC)C(O)=O)=O)NC[C@@H](NC[C@H](CS)N)[C@@H](C)C
Synonyms:- <span class="text-smallcaps">L</smallcap>-Methionine, N-[(2S)-2-[[(2R)-2-amino-3-mercaptopropyl]amino]-3-methylbutyl]-<smallcap>L</span>-phenylalanyl-
- <span class="text-smallcaps">L</smallcap>-Methionine, N-[N-[2-[(2-amino-3-mercaptopropyl)amino]-3-methylbutyl]-<smallcap>L</span>-phenylalanyl]-, [S-(R*,S*)]-
- B 581
- Cys-((R))-Val-((R))-Phe-Met
- Ftase Inhibitor I
- H-Cys-(R)-Val-(R)-Phe-Met-Oh
- N-[(2S)-2-[[(2R)-2-Amino-3-mercaptopropyl]amino]-3-methylbutyl]-<span class="text-smallcaps">L</smallcap>-phenylalanyl-<smallcap>L</span>-methionine
- N-[(2S)-2-{[(2R)-2-amino-3-sulfanylpropyl]amino}-3-methylbutyl]-L-phenylalanyl-L-methionine
- N-[(S)-2-((R)-2-Amino-3-Mercapto-Propylamino)-3-Methyl-Butyl]-Phe-Met-Oh
- N-[2(S)-(2(R)-2-Amino-3-Mercaptopropylamino)-3-Methylbutyl]-L-Phenylalanyl-L-Methionine
- N-[2(S)-[2(R)-Amino-3-Mercaptopropylamino]-3-Methyl-Butyl]-Phe-Met
- N-[2(S)-[2(R)-Amino-3-Mercaptopropylamino]-3-Methylbutyl]-Phe-Met-Oh
- N-[(2S)-2-[[(2R)-2-Amino-3-mercaptopropyl]amino]-3-methylbutyl]-L-phenylalanyl-L-methionine
- L-Methionine, N-[(2S)-2-[[(2R)-2-amino-3-mercaptopropyl]amino]-3-methylbutyl]-L-phenylalanyl-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
L-Methionine, N-[(2S)-2-[[(2R)-2-amino-3-mercaptopropyl]amino]-3-methylbutyl]-L-phenylalanyl-
CAS:Formula:C22H38N4O3S2Molecular weight:470.6921H-Cys-psi(CH2NH)Val-psi(CH2NH)Phe-Met-OH trifluoroacetate salt
CAS:FTI-277 is a peptidomimetic compound that inhibits HIV-1 protease. FTI-277 is an orally active, potent, and selective inhibitor of HIV-1 protease. The drug has been shown to be effective in the treatment of HIV infection in various clinical trials. FTI-277 inhibited HIV replication in activated cells and disrupted virion production by binding to the target enzyme. FTI-277 also has potential for use as a diagnostic tool for detecting the presence of HIV in body fluids.Formula:C22H38N4O3S2Purity:Min. 95%Molecular weight:470.69 g/molB 581
CAS:B 581 is an inhibitor that specifically blocks farnesylated.Formula:C22H38N4O3S2Purity:98%Color and Shape:SolidMolecular weight:470.69H-Cys-psi(CH₂NH)Val-psi(CH₂NH)Phe-Met-OH
CAS:B581, Cys-psi(CH₂NH)-Val- psi[CH₂NH]-Phe-Met is a farnesyltransferase (FTase) inhibitor of special stability and membrane permeability. Due to its high selectivity, B581 is more than 30-fold more active against FTase (IC₅₀ = 21 nM in vitro) than against geranylgeranyltransferase (GGTase). Inhibitors of the farnesyltransferase are potential candidates for the development of anticancer drugs.
Formula:C22H38N4O3S2Purity:95.7%Molecular weight:470.7




