CAS 149771-09-5
:Ethyl 2-amino-4-(trifluoromethyl)-5-pyrimidinecarboxylate
Description:
Ethyl 2-amino-4-(trifluoromethyl)-5-pyrimidinecarboxylate is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a trifluoromethyl group at the 4-position significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. The ethyl ester functional group contributes to its reactivity, making it amenable to hydrolysis and other chemical transformations. This compound is often studied for its potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. Its amino group at the 2-position may participate in hydrogen bonding, influencing solubility and interaction with biological targets. Overall, the unique combination of functional groups and the pyrimidine core makes this compound of interest in medicinal chemistry and related fields.
Formula:C8H8F3N3O2
InChI:InChI=1S/C8H8F3N3O2/c1-2-16-6(15)4-3-13-7(12)14-5(4)8(9,10)11/h3H,2H2,1H3,(H2,12,13,14)
InChI key:InChIKey=OUACXMUEZBQRBJ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(C(F)(F)F)=NC(N)=NC1
Synonyms:- Ethyl 2-amino-4-(trifluoromethyl)-5-pyrimidinecarboxylate
- 5-Pyrimidinecarboxylic acid, 2-amino-4-(trifluoromethyl)-, ethyl ester
- 2-Amino-4-trifluoromethylpyrimidine-5-carboxylic acid ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Pyrimidinecarboxylic acid, 2-amino-4-(trifluoromethyl)-, ethyl ester
CAS:Formula:C8H8F3N3O2Purity:97%Color and Shape:SolidMolecular weight:235.1632Ethyl 2-amino-4-(trifluoromethyl)pyrimidine-5-carboxylate
CAS:Ethyl 2-amino-4-(trifluoromethyl)pyrimidine-5-carboxylatePurity:≥95%Color and Shape:SolidMolecular weight:235.16g/molEthyl 2-amino-4-(trifluoromethyl)pyrimidine-5-carboxylate
CAS:Formula:C8H8F3N3O2Purity:97%Color and Shape:SolidMolecular weight:235.166Ethyl 2-amino-4-(trifluoromethyl)pyrimidine-5-carboxylate
CAS:<p>Ethyl 2-amino-4-(trifluoromethyl)pyrimidine-5-carboxylate is a small molecule that is a potent inhibitor of diacylglycerol acyltransferase. The compound has been shown to be an efficient inhibitor of this enzyme, which is involved in the synthesis of diacylglycerol. Diacylglycerol acyltransferase catalyzes the transfer of an acyl group from an acyl-carrier protein (ACP) to glycerol 3-phosphate, forming lysophosphatidic acid and releasing CoA. The inhibition of this enzyme leads to drastically reduced levels of diacylglycerol, which may have implications for the treatment of metabolic syndrome and diabetes.</p>Formula:C8H8F3N3O2Purity:Min. 95%Molecular weight:235.16 g/mol



