CymitQuimica logo

CAS 149968-28-5

:

1H-Imidazole-4-carboxylic acid, 2-butyl-5-chloro-

Description:
1H-Imidazole-4-carboxylic acid, 2-butyl-5-chloro- is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a butyl side chain, which influences its hydrophobic characteristics and solubility in organic solvents. The presence of a chlorine atom at the 5-position of the imidazole ring introduces additional reactivity and can affect the compound's biological activity. Typically, imidazole derivatives are known for their roles in various biological processes and can exhibit antimicrobial, antifungal, or anti-inflammatory properties. The specific arrangement of substituents in this compound may also influence its interaction with biological targets, making it of interest in pharmaceutical research. Overall, the combination of the imidazole core, carboxylic acid, and halogen substituent contributes to the unique chemical behavior and potential applications of this compound in medicinal chemistry and related fields.
Formula:C8H11ClN2O2
InChI:InChI=1S/C8H11ClN2O2/c1-2-3-4-5-10-6(8(12)13)7(9)11-5/h2-4H2,1H3,(H,10,11)(H,12,13)
InChI key:FETCESOEGZHHTR-UHFFFAOYSA-N
SMILES:CCCCC1=NC(=C(N1)Cl)C(=O)O
Found 3 products.