CymitQuimica logo

CAS 149968-36-5

:

1,3-BIS(DI-T-BUTYLPHOSPHINOMETHYL)BENZENE

Description:
1,3-Bis(di-t-butylphosphinomethyl)benzene is an organophosphorus compound characterized by its unique structure, which features a benzene ring substituted with two di-t-butylphosphinomethyl groups. This compound is notable for its potential applications in coordination chemistry and catalysis due to the presence of phosphorus-containing functional groups that can act as ligands. The bulky t-butyl groups enhance the steric hindrance around the phosphorus atoms, which can influence the reactivity and stability of the compound. Additionally, the presence of multiple phosphine functionalities allows for the formation of various metal complexes, making it of interest in the field of organometallic chemistry. The compound is typically synthesized through a multi-step organic reaction process, and its properties, such as solubility and thermal stability, can vary based on the specific conditions of synthesis and storage. Safety precautions should be observed when handling this compound, as organophosphorus compounds can exhibit toxicity and require careful management in laboratory settings.
Formula:C24H44P2
InChI:InChI=1S/C24H44P2/c1-21(2,3)25(22(4,5)6)17-19-14-13-15-20(16-19)18-26(23(7,8)9)24(10,11)12/h13-16H,17-18H2,1-12H3
InChI key:VNLHPVUKSKTUPA-UHFFFAOYSA-N
SMILES:CC(C)(C)P(CC1=CC(=CC=C1)CP(C(C)(C)C)C(C)(C)C)C(C)(C)C
Synonyms:
  • 1,3-Bis(Di-Tert-Butylphosphinomethyl)Benzene
  • 1,3-Bis(di-t-butylphosphinomethyl)benzene,99%
Found 5 products.