CAS 149997-91-1

L-Leucine,L-seryl-L-seryl-L-isoleucyl-L-a-glutamyl-L-phenylalanyl-L-alanyl-L-arginyl-

Description:

The chemical substance with the name "L-Leucine, L-seryl-L-seryl-L-isoleucyl-L-a-glutamyl-L-phenylalanyl-L-alanyl-L-arginyl-" and CAS number 149997-91-1 is a peptide composed of multiple amino acids. This compound is characterized by its sequence of L-amino acids, which are the building blocks of proteins. The presence of various amino acids, including leucine, serine, isoleucine, glutamic acid, phenylalanine, alanine, and arginine, suggests that it may exhibit diverse biological activities and functions, potentially influencing protein synthesis, metabolism, and cellular signaling. Peptides like this one can be involved in various physiological processes and may have applications in biotechnology and pharmaceuticals. The specific properties, such as solubility, stability, and biological activity, would depend on the precise sequence and structure of the peptide, as well as environmental factors like pH and temperature. Further studies would be necessary to elucidate its full range of characteristics and potential applications.

Formula: C₄₁H₆₇N₁₁O₁₃

InChI: InChI=1S/C41H67N11O13/c1-6-22(4)32(52-38(62)30(20-54)51-34(58)25(42)19-53)39(63)48-27(14-15-31(55)56)36(60)49-28(18-24-11-8-7-9-12-24)37(61)46-23(5)33(57)47-26(13-10-16-45-41(43)44)35(59)50-29(40(64)65)17-21(2)3/h7-9,11-12,21-23,25-30,32,53-54H,6,10,13-20,42H2,1-5H3,(H,46,61)(H,47,57)(H,48,63)(H,49,60)(H,50,59)(H,51,58)(H,52,62)(H,55,56)(H,64,65)(H4,43,44,45)/t22-,23-,25-,26-,27-,28-,29-,30-,32-/m0/s1

InChI key: UBVOHDHFHIMSCO-YWZBYMRGSA-N

SMILES: CC[C@H](C)[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CC(C)C)C(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H](CO)N

HSV-gB2 (498-505)

CAS: 149997-91-1

HSV-gB2 (498-505)

Formula: C₄₁H₆₇N₁₁O₁₃

Purity: 99.71%

Molecular weight: 922.04

Ref: 54-OR1134020

HSV-gB2 (498-505)

CAS: 149997-91-1

HSV-gB2(498-505): immunodominant epitope from HSV glycoprotein B. H-2Kb-restricted, HSV-1/2 cross-reactive CTL target.

Formula: C₄₁H₆₇N₁₁O₁₃

Purity: 99.28%

Color and Shape: Solid

Molecular weight: 922.04

Ref: TM-TP1534

HSV-gB2 (498-505)

CAS: 149997-91-1

Formula: C₄₁H₆₇N₁₁O₁₃

Purity: 99.71%

Molecular weight: 922.0366

Ref: IN-DA01XE4L

HSV-gB2 (498-505) acetate

CAS: 149997-91-1

Custom research peptide; min purity 95%.

Formula: C₄₁H₆₇N₁₁O₁₃•(C₂H₄O₂)x

Purity: Min. 95%

Molecular weight: 922.06 g/mol

Ref: 3D-PH17009