CAS 150017-88-2

1,10-DIBROMODECANE-D20

Description:

1,10-Dibromodecane-D20 is a chemical compound that belongs to the class of dibrominated alkanes, specifically a linear alkane with a total of ten carbon atoms and two bromine substituents located at the first and tenth carbon positions. The "D20" designation indicates that this compound is deuterated, meaning that some of the hydrogen atoms have been replaced with deuterium, a stable isotope of hydrogen. This modification can enhance the compound's utility in various applications, particularly in nuclear magnetic resonance (NMR) spectroscopy, where deuteration helps to reduce background signals from hydrogen. The presence of bromine atoms contributes to the compound's reactivity, making it useful in organic synthesis and as a potential intermediate in the production of other chemical substances. Additionally, the linear structure of 1,10-dibromodecane-D20 influences its physical properties, such as boiling and melting points, which are typically higher than those of non-brominated alkanes due to increased molecular weight and intermolecular interactions. Safety and handling precautions should be observed due to the potential hazards associated with brominated compounds.

Formula: C₁₀Br₂D₂₀

InChI: InChI=1S/C10H20Br2/c11-9-7-5-3-1-2-4-6-8-10-12/h1-10H2/i1D2,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2

InChI key: GTQHJCOHNAFHRE-KHKAULECSA-N

SMILES: [2H]C([2H])(C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])Br)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])Br

Synonyms:

• 1,10-Dibromocane-D20

1,10-Dibromodecane-d20

CAS: 150017-88-2, 4101-68-2

Formula: Br(CD₂)₁₀Br

Purity: 98 atom % D

Color and Shape: Colorless Pale-Yellow Liquid Or Solid

Molecular weight: 318.11871

Ref: 3U-D2659

1,10-Dibromodecane-d20

Controlled Product

CAS: 150017-88-2

Applications 1,10-Dibromodecane-d20 (CAS# 150017-88-2) is a useful isotopically labeled research compound.

Formula: C₁₀D₂₀Br₂

Color and Shape: Neat

Molecular weight: 320.197

Ref: TR-D448869