CAS 1502-24-5
:2,3-Dimethylcyclohexanol
Description:
2,3-Dimethylcyclohexanol is a cyclic alcohol characterized by its six-membered carbon ring with two methyl groups attached to the second and third carbon atoms. This compound is a colorless to pale yellow liquid at room temperature, exhibiting a characteristic alcohol odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic cyclohexane ring. The presence of hydroxyl (-OH) functional group imparts moderate polarity, influencing its reactivity and interactions. 2,3-Dimethylcyclohexanol can participate in various chemical reactions typical of alcohols, including dehydration to form alkenes and oxidation to yield ketones or aldehydes. Its structural isomers and stereochemistry can lead to different physical and chemical properties, making it an interesting compound for study in organic chemistry. Additionally, it is used as an intermediate in the synthesis of other organic compounds and may have applications in fragrance and flavor industries. Safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C8H16O
InChI:InChI=1S/C8H16O/c1-6-4-3-5-8(9)7(6)2/h6-9H,3-5H2,1-2H3
InChI key:InChIKey=KMVFQKNNDPKWOX-UHFFFAOYSA-N
SMILES:CC1C(C)CCCC1O
Synonyms:- 2,3-Dimethylcyclohexan-1-ol
- 2,3-Dimethylcyclohexanol
- Cyclohexanol, 2,3-dimethyl-
- 2,3-Dimethylcyclohexanol (mixture of isomers
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,3-Dimethylcyclohexanol (mixture of isomers)
CAS:Formula:C8H16OPurity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:128.222,3-Dimethylcyclohexanol
CAS:2,3-DimethylcyclohexanolFormula:C8H16OPurity:98%Color and Shape:Liquid-ClearMolecular weight:128.212042,3-Dimethylcyclohexanol
CAS:2,3-Dimethylcyclohexanol is a tertiary butyl alcohol that has a boiling point of about 200°C. It is used in the production of esters, such as diethyl ester. 2,3-Dimethylcyclohexanol is also used in the production of cyclobutane and cyclohexanol. The reaction rate for this compound is slow and requires a large amount of heat to reach completion. This product reacts with aldehydes to form reaction products, which are usually volatile compounds. 2,3-Dimethylcyclohexanol can be synthesized from cyclobutane or cyclohexanol by reacting them with an organic acid or hydroxyl group.Formula:C8H16OPurity:Min. 95%Molecular weight:128.22 g/mol





