CymitQuimica logo

CAS 15029-40-0

:

2-cyano-N-(2-hydroxyethyl)acetamide

Description:
2-Cyano-N-(2-hydroxyethyl)acetamide, with the CAS number 15029-40-0, is an organic compound characterized by its functional groups, including a cyano group (-CN), an amide group (-CONH-), and a hydroxyl group (-OH) attached to a two-carbon ethyl chain. This compound typically appears as a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals and agrochemicals, particularly as a building block in the synthesis of more complex molecules. The presence of the cyano group may impart unique reactivity, making it useful in various chemical reactions, such as nucleophilic additions. Additionally, the hydroxyl group can enhance its reactivity and solubility, influencing its behavior in biological systems. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C5H8N2O2
InChI:InChI=1/C5H8N2O2/c6-2-1-5(9)7-3-4-8/h8H,1,3-4H2,(H,7,9)
InChI key:JBFRGXRQXZOZTA-UHFFFAOYSA-N
SMILES:C(C#N)C(=NCCO)O
Synonyms:
  • Acetamide, 2-cyano-N-(2-hydroxyethyl)-
  • 2-Cyano-N-(2-hydroxyethyl)acetamide
  • ST5124132
  • 2-cyano-N-(2-hydroxyethyl)ethanamide
Found 2 products.