CymitQuimica logo

CAS 1503-98-6

:

Cyclobutanecarboxamide

Description:
Cyclobutanecarboxamide, with the CAS number 1503-98-6, is an organic compound characterized by its cyclobutane ring structure attached to a carboxamide functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. Cyclobutanecarboxamide is known for its relatively low solubility in water, but it can dissolve in organic solvents such as ethanol and acetone. The presence of the carboxamide group imparts polar characteristics, influencing its reactivity and interactions with other chemical species. This compound may exhibit moderate stability under standard conditions, but it can undergo hydrolysis or other reactions under specific circumstances, particularly in the presence of strong acids or bases. Cyclobutanecarboxamide is of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential applications in the development of pharmaceuticals and agrochemicals. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled.
Formula:C5H9NO
InChI:InChI=1/C5H9NO/c6-5(7)4-2-1-3-4/h4H,1-3H2,(H2,6,7)
InChI key:MFNYBOWJWGPXFM-UHFFFAOYSA-N
SMILES:C1CC(C1)C(=N)O
Found 4 products.