CymitQuimica logo

CAS 150535-14-1

:

Methyl 2,3-dihydro-1H-indole-2-acetate

Description:
Methyl 2,3-dihydro-1H-indole-2-acetate, with the CAS number 150535-14-1, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features an acetate functional group, contributing to its reactivity and solubility properties. Typically, compounds of this nature exhibit moderate polarity, making them soluble in organic solvents while having limited solubility in water. Methyl 2,3-dihydro-1H-indole-2-acetate may participate in various chemical reactions, including esterification and nucleophilic substitutions, due to the presence of the acetate moiety. Additionally, its indole framework is known for biological activity, often serving as a scaffold in medicinal chemistry. The compound's physical properties, such as boiling point and melting point, can vary based on purity and specific conditions. Overall, this compound is of interest in both synthetic organic chemistry and potential pharmaceutical applications due to its structural characteristics.
Formula:C11H13NO2
InChI:InChI=1S/C11H13NO2/c1-14-11(13)7-9-6-8-4-2-3-5-10(8)12-9/h2-5,9,12H,6-7H2,1H3
InChI key:InChIKey=IAINXEYLEMFBPF-UHFFFAOYSA-N
SMILES:C(C(OC)=O)C1CC=2C(N1)=CC=CC2
Synonyms:
  • 1H-Indole-2-acetic acid, 2,3-dihydro-, methyl ester
  • 2-Methoxycarbonylmethylindoline
  • Methyl 2,3-dihydro-1H-indole-2-acetate
Found 4 products.