
CAS 150576-46-8
:(+/-)-TRANS-1,2-BIS(CHLOROACETAMIDO)CYCLOHEXANE
Description:
(+/-)-TRANS-1,2-BIS(CHLOROACETAMIDO)CYCLOHEXANE is a chemical compound characterized by its unique bicyclic structure, which includes a cyclohexane ring with two chlorinated acetamido groups attached at the 1 and 2 positions. This compound is typically a white to off-white solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of chlorinated acetamido groups contributes to its reactivity and biological activity, making it a subject of interest in various chemical research fields. The compound's chirality, indicated by the (+/-) designation, suggests that it exists as a racemic mixture of enantiomers, which can exhibit different biological properties. Its molecular interactions, stability, and solubility are influenced by the functional groups present, and it may undergo various chemical reactions typical of amides and halogenated compounds. Safety and handling precautions are essential due to the presence of chlorine, which can pose health risks.
Formula:C10H16Cl2N2O2
InChI:InChI=1S/C10H16Cl2N2O2/c11-5-9(15)13-7-3-1-2-4-8(7)14-10(16)6-12/h7-8H,1-6H2,(H,13,15)(H,14,16)/t7-,8-/m0/s1
InChI key:NXWRKAARNQHEEG-YUMQZZPRSA-N
SMILES:C1CC[C@@H]([C@H](C1)NC(=O)CCl)NC(=O)CCl
Synonyms:- (+/-)-TRANS-1,2-BIS(CHLOROACETAMIDO)CYCLOHEXANE
- rac-trans-N,N'-1,2-Cyclohexanediyl-bis-2-chloro-acetaMide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(+/-)-trans-1,2-Bis(chloroacetamido)cyclohexane
CAS:Formula:C10H16Cl2N2O2Color and Shape:SolidMolecular weight:267.1522(+/-)-trans-1,2-Bis(chloroacetamido)cyclohexane
CAS:Controlled ProductApplications (+/-)-trans-1,2-Bis(chloroacetamido)cyclohexane (cas# 150576-46-8) is a compound useful in organic synthesis.
References Woycechowsky, K.J., et al.: Chem. Biol., 6, 871 (1999)Formula:C10H16Cl2N2O2Color and Shape:NeatMolecular weight:267.15


