CAS 15069-92-8: 5-Hydroxy-2-pyridinecarboxylic acid
Description:5-Hydroxy-2-pyridinecarboxylic acid, also known as 5-hydroxypicolinic acid, is an organic compound characterized by its pyridine ring structure with a hydroxyl group and a carboxylic acid functional group. This compound is typically a white to off-white crystalline solid that is soluble in water and polar organic solvents. It exhibits both acidic and basic properties due to the presence of the carboxylic acid and the nitrogen atom in the pyridine ring, allowing it to participate in various chemical reactions, including coordination with metal ions. 5-Hydroxy-2-pyridinecarboxylic acid is of interest in various fields, including biochemistry and materials science, due to its potential applications in chelation therapy, as a ligand in coordination chemistry, and in the synthesis of pharmaceuticals. Additionally, it may play a role in biological systems, particularly in the metabolism of certain nutrients. Its stability and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C6H4NO3
InChI:InChI=1/C6H5NO3/c8-4-1-2-5(6(9)10)7-3-4/h1-3,8H,(H,9,10)/p-1
- Synonyms:
- 5-Hydroxy-2-pyridinecarboxylic acid, monohydrat
- 5-Hydroxypicolinic Acid
- 5-Hydroxypyridine-2-carboxylic acid
- 5-Hydroxypyridine-2-Carboxylate

5-Hydroxypyridine-2-carboxylic Acid
Ref: 3B-H1471
1g | 92.00 € | ||
5g | 278.00 € |

5-Hydroxypyridine-2-carboxylic acid, 98+%
Ref: 02-H64265
1g | To inquire | ||
5g | To inquire | ||
25g | To inquire |

2-Pyridinecarboxylic acid, 5-hydroxy-
Ref: IN-DA001MT7
1g | 25.00 € | ||
5g | 46.00 € | ||
10g | 59.00 € | ||
25g | 111.00 € | ||
100g | 255.00 € |

5-Hydroxypyridine-2-carboxylic acid
Ref: 54-OR5545
1g | 32.00 € | ||
5g | 42.00 € |

Ref: FT-H11252
5g | To inquire | ||
25g | To inquire |

5-Hydroxypyridine-2-carboxylic acid
Ref: 10-F066001
1g | 24.00 € | ||
5g | 20.00 € | ||
10g | 32.00 € | ||
25g | 80.00 € | ||
100g | 267.00 € |

5-Hydroxypicolinic Acid
Controlled ProductRef: TR-H951275
10g | 104.00 € | ||
25g | 178.00 € | ||
50g | 372.00 € |

5-Hydroxy-pyridine-2-carboxylic acid
Ref: 3D-FH13060
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information |