CAS 15069-92-8
:5-Hydroxy-2-pyridinecarboxylic acid
Description:
5-Hydroxy-2-pyridinecarboxylic acid, also known as 5-hydroxypicolinic acid, is an organic compound characterized by its pyridine ring structure with a hydroxyl group and a carboxylic acid functional group. This compound is typically a white to off-white crystalline solid that is soluble in water and polar organic solvents. It exhibits both acidic and basic properties due to the presence of the carboxylic acid and the nitrogen atom in the pyridine ring, allowing it to participate in various chemical reactions, including coordination with metal ions. 5-Hydroxy-2-pyridinecarboxylic acid is of interest in various fields, including biochemistry and materials science, due to its potential applications in chelation therapy, as a ligand in coordination chemistry, and in the synthesis of pharmaceuticals. Additionally, it may play a role in biological systems, particularly in the metabolism of certain nutrients. Its stability and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C6H4NO3
InChI:InChI=1/C6H5NO3/c8-4-1-2-5(6(9)10)7-3-4/h1-3,8H,(H,9,10)/p-1
SMILES:c1cc(C(=O)O)ncc1[O-]
Synonyms:- 5-Hydroxy-2-pyridinecarboxylic acid, monohydrat
- 5-Hydroxypicolinic Acid
- 5-Hydroxypyridine-2-carboxylic acid
- 5-Hydroxypyridine-2-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
5-Hydroxypyridine-2-carboxylic Acid
CAS:Formula:C6H5NO3Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:139.115-Hydroxypyridine-2-carboxylic acid, 98+%
CAS:Useful synthetic intermediate. Also intermediate for pharmaceutical application. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item codeFormula:C6H4NO3Purity:98+%Molecular weight:138.105-Hydroxypyridine-2-carboxylic acid
CAS:5-Hydroxypyridine-2-carboxylic acidFormula:C6H5NO3Purity:95%Color and Shape:SolidMolecular weight:139.10882-Pyridinecarboxylic acid, 5-hydroxy-
CAS:Formula:C6H5NO3Purity:97%Color and Shape:SolidMolecular weight:139.10885-Hydroxypyridine-2-carboxylic acid
CAS:Formula:C6H5NO3Purity:97%Color and Shape:SolidMolecular weight:139.115-Hydroxypicolinic Acid
CAS:Controlled ProductStability Stable at Room Temperature
Applications A useful synthetic intermediate.Formula:C6H5NO3Color and Shape:NeatMolecular weight:139.11






