CymitQuimica logo

CAS 1507372-37-3

:

tert-butyl 4-acetyl-4-methylpiperidine-1-carboxylate

Description:
Tert-butyl 4-acetyl-4-methylpiperidine-1-carboxylate is a chemical compound characterized by its piperidine structure, which includes a tert-butyl group and an acetyl substituent. This compound typically exhibits properties common to esters, such as being a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is generally soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic tert-butyl group. The presence of the acetyl group contributes to its reactivity, making it a potential intermediate in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. The compound may also exhibit specific biological activities, which can be explored in medicinal chemistry contexts. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Proper storage conditions are essential to maintain its stability and prevent degradation.
Formula:C13H23NO3
InChI:InChI=1S/C13H23NO3/c1-10(15)13(5)6-8-14(9-7-13)11(16)17-12(2,3)4/h6-9H2,1-5H3
InChI key:YBYYACQGRIOADW-UHFFFAOYSA-N
SMILES:CC(=O)C1(CCN(CC1)C(=O)OC(C)(C)C)C
Synonyms:
  • tert-butyl 4-acetyl-4-methylpiperidine-1-carboxylate
Found 5 products.