CymitQuimica logo

CAS 150763-46-5

:

trans-4'-Ethyl-1,1'-bicyclohexyl-4-one

Description:
Trans-4'-Ethyl-1,1'-bicyclohexyl-4-one, with the CAS number 150763-46-5, is an organic compound characterized by its bicyclic structure, which consists of two fused cyclohexane rings with an ethyl group and a ketone functional group. This compound typically exhibits a relatively high boiling point and moderate solubility in organic solvents, reflecting its hydrophobic nature due to the presence of multiple carbon atoms in its structure. The trans configuration of the ethyl group influences its stereochemistry, potentially affecting its reactivity and interactions with other molecules. As a ketone, it may participate in various chemical reactions, including nucleophilic additions and oxidation processes. Its unique structure may also impart specific physical properties, such as distinct melting and boiling points, and it may exhibit interesting optical properties. Due to its structural characteristics, trans-4'-Ethyl-1,1'-bicyclohexyl-4-one may find applications in organic synthesis, materials science, or as a potential intermediate in the production of more complex chemical entities.
Formula:C14H24O
InChI:InChI=1S/C14H24O/c1-2-11-3-5-12(6-4-11)13-7-9-14(15)10-8-13/h11-13H,2-10H2,1H3
InChI key:ICCIOWLZPJIEBA-UHFFFAOYSA-N
SMILES:CCC1CCC(CC1)C2CCC(=O)CC2
Synonyms:
  • 4-(Trans-4-Ethylcyclohexyl)Cyclohexanone
  • trans-4'-ethyl-(1,1'-bicyclohexyl)-4-one
Found 6 products.