CymitQuimica logo

CAS 1513-45-7

:

4-(Trifluoromethoxy)benzenesulfonamide

Description:
4-(Trifluoromethoxy)benzenesulfonamide, with the CAS number 1513-45-7, is an organic compound characterized by the presence of a sulfonamide functional group attached to a benzene ring that is further substituted with a trifluoromethoxy group. This compound typically exhibits a white to off-white crystalline appearance. The trifluoromethoxy group contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The sulfonamide moiety is known for its applications in pharmaceuticals, particularly as antibacterial agents. The presence of fluorine atoms enhances the compound's stability and reactivity, making it of interest in medicinal chemistry and material science. Additionally, 4-(Trifluoromethoxy)benzenesulfonamide may exhibit specific solubility characteristics in various solvents, influencing its application in different chemical reactions or formulations. Its synthesis and reactivity can be explored in the context of developing new therapeutic agents or as intermediates in organic synthesis. Overall, this compound represents a significant intersection of organic chemistry and pharmacology.
Formula:C7H6F3NO3S
InChI:InChI=1S/C7H6F3NO3S/c8-7(9,10)14-5-1-3-6(4-2-5)15(11,12)13/h1-4H,(H2,11,12,13)
InChI key:InChIKey=RGOJCHYYBKMRLL-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=CC=C(S(N)(=O)=O)C=C1
Synonyms:
  • 4-(Trifluoromethoxy)Benzenesulfonamide
  • 4-Trifluoromethoxyphenylsulfonamide
  • 4-[(Trifluoromethyl)oxy]benzenesulfonamide
  • Benzenesulfonamide, 4-(trifluoromethoxy)-
  • Benzenesulfonamide, p-(trifluoromethoxy)-
Found 5 products.