CymitQuimica logo

CAS 15136-12-6

:

L-Leucine, N-[(1,1-dimethylethoxy)carbonyl]-L-leucyl-, methyl ester

Description:
L-Leucine, N-[(1,1-dimethylethoxy)carbonyl]-L-leucyl-, methyl ester, with the CAS number 15136-12-6, is a synthetic derivative of the essential amino acid L-leucine. This compound features a protective group, specifically a tert-butoxycarbonyl (Boc) group, which is commonly used in peptide synthesis to protect the amino group during chemical reactions. The methyl ester functionality indicates that the carboxylic acid group of L-leucine is esterified, enhancing its lipophilicity and potentially influencing its solubility and reactivity. L-Leucine itself plays a crucial role in protein synthesis and is vital for muscle repair and growth. The presence of the Boc group allows for selective reactions, making this compound useful in the synthesis of peptides and other complex organic molecules. Its characteristics include being a white to off-white solid, with stability under standard conditions, and it is typically handled in a laboratory setting with appropriate safety measures due to its chemical reactivity.
Formula:C18H34N2O5
InChI:InChI=1S/C18H34N2O5/c1-11(2)9-13(20-17(23)25-18(5,6)7)15(21)19-14(10-12(3)4)16(22)24-8/h11-14H,9-10H2,1-8H3,(H,19,21)(H,20,23)/t13-,14-/m0/s1
InChI key:LFRFWMCLWQNBFR-KBPBESRZSA-N
SMILES:CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)OC)NC(=O)OC(C)(C)C
Synonyms:
  • Boc-Leu-Leu
Found 4 products.