CymitQuimica logo

CAS 151361-87-4

:

1-ETHYNYL-3,5-DIFLUOROBENZENE

Description:
1-Ethyne-3,5-difluorobenzene, with the CAS number 151361-87-4, is an organic compound characterized by a benzene ring substituted with two fluorine atoms and an ethynyl group. The presence of the ethynyl group introduces a triple bond, which contributes to the compound's reactivity and potential applications in organic synthesis. The fluorine substituents enhance the compound's electronegativity and influence its physical properties, such as boiling and melting points, as well as its solubility in various solvents. This compound is typically used in the synthesis of more complex organic molecules and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique structure allows for various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data sheets should be consulted for handling and storage guidelines, as fluorinated compounds can exhibit toxicity and environmental persistence. Overall, 1-ethynyl-3,5-difluorobenzene is a valuable compound in the field of synthetic organic chemistry.
Formula:C8H4F2
InChI:InChI=1S/C8H4F2/c1-2-6-3-7(9)5-8(10)4-6/h1,3-5H
InChI key:OTDGZDMGSFBZLI-UHFFFAOYSA-N
SMILES:C#CC1=CC(=CC(=C1)F)F
Found 5 products.