CymitQuimica logo

CAS 151486-56-5

:

Boron,[4-butyl-2-[1-(4-butyl-3,5-dimethyl-2H-pyrrol-2-ylidene-kN)ethyl]-3,5-dimethyl-1H-pyrrolato-kN]difluoro-, (T-4)-

Description:
The chemical substance known as Boron, [4-butyl-2-[1-(4-butyl-3,5-dimethyl-2H-pyrrol-2-ylidene-kN)ethyl]-3,5-dimethyl-1H-pyrrolato-kN]difluoro-, (T-4)-, with CAS number 151486-56-5, is a boron-containing compound characterized by its complex organic structure. It features a boron atom coordinated to a pyrrole-derived ligand, which includes multiple butyl and dimethyl substituents. The presence of difluoro groups indicates that fluorine atoms are attached to the boron, enhancing its reactivity and potentially influencing its electronic properties. This compound may exhibit unique chemical behavior due to the interplay between the boron center and the organic ligands, making it of interest in various fields such as materials science, catalysis, and medicinal chemistry. Its specific applications and reactivity would depend on the overall molecular structure and the functional groups present, which can affect solubility, stability, and interaction with other chemical species. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C22H33BF2N2
InChI:InChI=1S/C22H33BF2N2/c1-8-10-12-19-14(3)21-16(5)22-15(4)20(13-11-9-2)18(7)27(22)23(24,25)26(21)17(19)6/h8-13H2,1-7H3
InChI key:XWUUMDJCWNZHAZ-UHFFFAOYSA-N
SMILES:[B-]1(N2C(=C(C(=C2C(=C3[N+]1=C(C(=C3C)CCCC)C)C)C)CCCC)C)(F)F
Synonyms:
  • Boron,[4-butyl-2-[1-(4-butyl-3,5-dimethyl-2H-pyrrol-2-ylidene)ethyl]-3,5-dimethyl-1H-pyrrolato-N1,N2]difluoro-,(T-4)-
  • Pm 580
  • Pyrromethene 580
Found 4 products.