CymitQuimica logo

CAS 151519-23-2

:

3H-1,2,4-Triazole-3-thione,2,4-dihydro-5-methyl-4-(1-methylethyl)-(9CI)

Description:
3H-1,2,4-Triazole-3-thione, 2,4-dihydro-5-methyl-4-(1-methylethyl)-, commonly referred to by its CAS number 151519-23-2, is a heterocyclic compound featuring a triazole ring, which is a five-membered ring containing three nitrogen atoms. This compound exhibits thione characteristics due to the presence of a sulfur atom bonded to a carbon atom in the triazole structure. It is typically characterized by its potential biological activity, which may include antifungal or herbicidal properties, making it of interest in agricultural and pharmaceutical applications. The presence of methyl and isopropyl groups contributes to its hydrophobic nature, influencing its solubility and reactivity. Additionally, the compound's structure allows for various interactions with biological targets, which can be explored for therapeutic purposes. Overall, 3H-1,2,4-Triazole-3-thione is notable for its unique structural features and potential utility in various chemical and biological contexts.
Formula:C6H11N3S
InChI:InChI=1S/C6H11N3S/c1-4(2)9-5(3)7-8-6(9)10/h4H,1-3H3,(H,8,10)
InChI key:VASORQSEVCDPBL-UHFFFAOYSA-N
SMILES:CC1=NNC(=S)N1C(C)C
Found 3 products.