CymitQuimica logo

CAS 151588-38-4

:

[4-(butylsulfanyl)phenyl]boronic acid

Description:
[4-(Butylsulfanyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a butylsulfanyl group. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The butylsulfanyl group enhances its solubility in organic solvents and may influence its reactivity and selectivity in chemical reactions. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds. The compound's structure suggests potential applications in the development of pharmaceuticals and agrochemicals, as well as in materials science. Its stability, reactivity, and functionalization potential make it a valuable building block in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C10H15BO2S
InChI:InChI=1/C10H15BO2S/c1-2-3-8-14-10-6-4-9(5-7-10)11(12)13/h4-7,12-13H,2-3,8H2,1H3
InChI key:BZLVENAORLQLEA-UHFFFAOYSA-N
SMILES:CCCCSc1ccc(cc1)B(O)O
Synonyms:
  • Boronic acid, B-[4-(butylthio)phenyl]-
  • [4-(Butylsulfanyl)phenyl]boronic acid
Found 2 products.