CymitQuimica logo

CAS 151731-50-9

:

2,2-Dimethyl-8-(3-methyl-2-buten-1-yl)-2H-1-benzopyran-6-carboxylic acid

Description:
2,2-Dimethyl-8-(3-methyl-2-buten-1-yl)-2H-1-benzopyran-6-carboxylic acid, with CAS number 151731-50-9, is a complex organic compound belonging to the class of flavonoids, which are known for their diverse biological activities. This substance features a benzopyran core structure, characterized by a fused benzene and pyran ring, which is further substituted with various functional groups, including a carboxylic acid and multiple alkyl groups. The presence of the dimethyl and isoprenyl substituents contributes to its unique chemical properties and potential reactivity. This compound may exhibit antioxidant, anti-inflammatory, and antimicrobial activities, typical of many flavonoids, making it of interest in pharmaceutical and nutraceutical research. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in biological systems. Overall, 2,2-Dimethyl-8-(3-methyl-2-buten-1-yl)-2H-1-benzopyran-6-carboxylic acid represents a fascinating area of study within organic chemistry and natural product research.
Formula:C17H20O3
InChI:InChI=1S/C17H20O3/c1-11(2)5-6-12-9-14(16(18)19)10-13-7-8-17(3,4)20-15(12)13/h5,7-10H,6H2,1-4H3,(H,18,19)
InChI key:InChIKey=MCQWYGYDCGLCJD-UHFFFAOYSA-N
SMILES:C(C=C(C)C)C1=C2C(=CC(C(O)=O)=C1)C=CC(C)(C)O2
Synonyms:
  • 2,2-Dimethyl-8-(3-methyl-2-butenyl)-2H-chromene-6-carboxylic acid
  • 2,2-Dimethyl-8-(3-methyl-2-buten-1-yl)-2H-1-benzopyran-6-carboxylic acid
  • 2H-1-Benzopyran-6-carboxylic acid, 2,2-dimethyl-8-(3-methyl-2-buten-1-yl)-
  • 2,2-Dimethyl-8-(3-methylbut-2-en-1-yl)-2H-chromene-6-carboxylic acid
  • 2H-1-Benzopyran-6-carboxylic acid, 2,2-dimethyl-8-(3-methyl-2-butenyl)-
Found 4 products.