CAS 15174-69-3
:4-hydroxy-3-methylbenzaldehyde
Description:
4-Hydroxy-3-methylbenzaldehyde, also known as p-hydroxy-m-tolualdehyde, is an organic compound characterized by a benzene ring substituted with a hydroxyl group and an aldehyde group, along with a methyl group. Its molecular formula is C8H8O2, indicating the presence of eight carbon atoms, eight hydrogen atoms, and two oxygen atoms. This compound typically appears as a pale yellow to light brown solid or liquid, depending on its purity and form. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water. The presence of the hydroxyl group contributes to its reactivity, allowing it to participate in various chemical reactions, including oxidation and condensation. 4-Hydroxy-3-methylbenzaldehyde is often used in organic synthesis and as an intermediate in the production of dyes, fragrances, and pharmaceuticals. Its unique structure also imparts specific properties, such as potential antioxidant activity, making it of interest in various fields, including materials science and medicinal chemistry.
Formula:C8H8O2
InChI:InChI=1/C8H8O2/c1-6-4-7(5-9)2-3-8(6)10/h2-5,10H,1H3
SMILES:Cc1cc(ccc1O)C=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Hydroxy-3-methylbenzaldehyde
CAS:Formula:C8H8O2Purity:>98.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:136.154-Hydroxy-3-methylbenzaldehyde
CAS:Formula:C8H8O2Purity:95%Color and Shape:SolidMolecular weight:136.14794-Hydroxy-3-methylbenzaldehyde
CAS:4-Hydroxy-3-methylbenzaldehydeFormula:C8H8O2Purity:95%Color and Shape:Off-white SolidMolecular weight:136.147924-Hydroxy-3-methylbenzaldehyde
CAS:4-Hydroxy-3-methylbenzaldehyde is an aromatic compound widely used in biochemical experiments and drug synthesis research.Formula:C8H8O2Purity:99.72%Color and Shape:SolidMolecular weight:136.154-Hydroxy-3-methylbenzaldehyde
CAS:4-Hydroxy-3-methylbenzaldehyde is a fungicidal agent that has been shown to have activity against Cryptococcus neoformans. It inhibits the mitochondrial functions of this fungus, which leads to cell death by disrupting the synthesis of fatty acids and other cellular components. 4-Hydroxy-3-methylbenzaldehyde binds to C. neoformans with high affinity, producing a reaction product that interferes with the organism's ability to produce butyric acid. The molecular modelling of this compound shows that it is a pyrazole ring with two benzyl groups on either side of an aldehyde group. This chemical also inhibits gram-negative bacteria by binding to fatty acids in their outer membrane.Formula:C8H8O2Purity:Min. 95%Color and Shape:PowderMolecular weight:136.15 g/mol4-Hydroxy-3-methylbenzaldehyde
CAS:Formula:C8H8O2Purity:97%Color and Shape:Solid, Crystalline Powder or PowderMolecular weight:136.154-Hydroxy-3-methylbenzaldehyde
CAS:Controlled ProductFormula:C8H8O2Color and Shape:NeatMolecular weight:136.15






