CAS 1520-96-3: perylene-D12
Description:Perylene-D12, with the CAS number 1520-96-3, is a deuterated form of perylene, a polycyclic aromatic hydrocarbon (PAH) known for its stability and fluorescence properties. As a deuterated compound, Perylene-D12 contains deuterium atoms, which are heavier isotopes of hydrogen, replacing some of the hydrogen atoms in the perylene structure. This modification enhances its utility in various applications, particularly in nuclear magnetic resonance (NMR) spectroscopy, where the presence of deuterium can improve spectral resolution and reduce background noise. Perylene itself is characterized by its planar structure, high thermal stability, and strong absorption and emission in the ultraviolet-visible spectrum, making it valuable in organic electronics, dyes, and as a fluorescent probe. The deuterated variant retains these properties while offering distinct advantages in analytical chemistry and research settings. Overall, Perylene-D12 serves as an important tool in both fundamental research and practical applications, particularly in the study of molecular interactions and dynamics.
Formula:C20D12
InChI:InChI=1/C20H12/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17/h1-12H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D
- Synonyms:
- (~2~H_12_)perylene
