CymitQuimica logo

CAS 152150-03-3

:

quinolin-5-ylacetic acid

Description:
Quinolin-5-ylacetic acid is an organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the heterocyclic ring. This substance features an acetic acid functional group attached to the quinoline at the 5-position, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in polar organic solvents. The presence of both the quinoline and carboxylic acid functionalities allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as quinoline derivatives are known for their biological activity. The compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological effects would depend on further empirical studies. Additionally, its molecular structure allows for various chemical reactions, making it a versatile intermediate in organic synthesis. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C11H9NO2
InChI:InChI=1/C11H9NO2/c13-11(14)7-8-3-1-5-10-9(8)4-2-6-12-10/h1-6H,7H2,(H,13,14)
InChI key:JFWDAGJPWJVGFG-UHFFFAOYSA-N
SMILES:c1cc(CC(=O)O)c2cccnc2c1
Synonyms:
  • 2-(Quinolin-5-Yl)Acetic Acid
  • 5-Quinolineacetic Acid
Found 1 products.