CAS 152273-12-6
:tert-butyl 4,4-dimethyl-4,5-dihydroimidazo[1,5-a]quinoxaline-3-carboxylate
Description:
Tert-butyl 4,4-dimethyl-4,5-dihydroimidazo[1,5-a]quinoxaline-3-carboxylate is a chemical compound characterized by its complex bicyclic structure, which includes an imidazoquinoxaline framework. This compound features a tert-butyl ester group, contributing to its solubility and stability. It typically exhibits moderate polarity due to the presence of both hydrophobic (tert-butyl) and polar (carboxylate) functional groups. The imidazoquinoxaline moiety is known for its potential biological activity, making this compound of interest in medicinal chemistry. It may exhibit properties such as fluorescence or specific reactivity due to its unique structure. The compound is likely to be a solid at room temperature and may require specific conditions for storage and handling, such as protection from moisture and light. As with many organic compounds, it is essential to consider safety data, including toxicity and environmental impact, when working with or studying this substance.
Formula:C17H21N3O2
InChI:InChI=1/C17H21N3O2/c1-16(2,3)22-15(21)13-14-17(4,5)19-11-8-6-7-9-12(11)20(14)10-18-13/h6-10,19H,1-5H3
SMILES:CC(C)(C)OC(=O)c1c2C(C)(C)Nc3ccccc3n2cn1
Synonyms:- Imidazo(1,5-a)quinoxaline-3-carboxylic acid, 4,5-dihydro-4,4-dimethyl-, 1,1-dimethylethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
U93631
CAS:GABAA antagonist; binds picrotoxin site, stabilizes inactive channel. Speeds GABA-induced Cl- decay, minor peak effect. Inhibits 5-HT3A receptors.Formula:C17H21N3O2Purity:99.65% - 99.76%Color and Shape:SolidMolecular weight:299.37U93631
CAS:U93631 is a subunit that belongs to the group of convulsants. It is a competitive antagonist at nicotinic acetylcholine receptors and has been shown to be effective against nervous system diseases such as epilepsy. The agonist muscimol, which binds to the GABA-A receptor, has been shown to have nootropic properties in rat models. U93631 inhibits 5-HT3a receptors and modulates α-subunit expression. This drug also has metabolic effects and can be used for the treatment of metabolic disorders such as obesity or diabetes.Formula:C17H21N3O2Purity:Min. 95%Molecular weight:299.37 g/mol



