CAS 152273-12-6

tert-butyl 4,4-dimethyl-4,5-dihydroimidazo[1,5-a]quinoxaline-3-carboxylate

Description:

Tert-butyl 4,4-dimethyl-4,5-dihydroimidazo[1,5-a]quinoxaline-3-carboxylate is a chemical compound characterized by its complex bicyclic structure, which includes an imidazoquinoxaline framework. This compound features a tert-butyl ester group, contributing to its solubility and stability. It typically exhibits moderate polarity due to the presence of both hydrophobic (tert-butyl) and polar (carboxylate) functional groups. The imidazoquinoxaline moiety is known for its potential biological activity, making this compound of interest in medicinal chemistry. It may exhibit properties such as fluorescence or specific reactivity due to its unique structure. The compound is likely to be a solid at room temperature and may require specific conditions for storage and handling, such as protection from moisture and light. As with many organic compounds, it is essential to consider safety data, including toxicity and environmental impact, when working with or studying this substance.

Formula: C₁₇H₂₁N₃O₂

InChI: InChI=1/C17H21N3O2/c1-16(2,3)22-15(21)13-14-17(4,5)19-11-8-6-7-9-12(11)20(14)10-18-13/h6-10,19H,1-5H3

SMILES: CC(C)(C)OC(=O)c1c2C(C)(C)Nc3ccccc3n2cn1

Synonyms:

• Imidazo(1,5-a)quinoxaline-3-carboxylic acid, 4,5-dihydro-4,4-dimethyl-, 1,1-dimethylethyl ester

U 93631

CAS: 152273-12-6

Formula: C₁₇H₂₁N₃O₂

Purity: 99%

Color and Shape: Solid

Molecular weight: 299.3675

Ref: IN-DA00ABTI

U93631

CAS: 152273-12-6

U93631

Formula: C₁₇H₂₁N₃O₂

Purity: ≥98%

Molecular weight: 299.37

Ref: 54-BUP13606

U93631

CAS: 152273-12-6

GABAA antagonist; binds picrotoxin site, stabilizes inactive channel. Speeds GABA-induced Cl- decay, minor peak effect. Inhibits 5-HT3A receptors.

Formula: C₁₇H₂₁N₃O₂

Purity: 99.65% - 99.76%

Color and Shape: Solid

Molecular weight: 299.37

Ref: TM-T3644

U93631

CAS: 152273-12-6

tert-Butyl 4,4-dimethyl-4,5-dihydroimidazo[1,5-a]quinoxaline-3-carboxylate

Formula: C₁₇H₂₁N₃O₂

Purity: 99%

Molecular weight: 299.37

Ref: IN-DG764665

U93631

CAS: 152273-12-6

U93631 is a subunit that belongs to the group of convulsants. It is a competitive antagonist at nicotinic acetylcholine receptors and has been shown to be effective against nervous system diseases such as epilepsy. The agonist muscimol, which binds to the GABA-A receptor, has been shown to have nootropic properties in rat models. U93631 inhibits 5-HT3a receptors and modulates α-subunit expression. This drug also has metabolic effects and can be used for the treatment of metabolic disorders such as obesity or diabetes.

Formula: C₁₇H₂₁N₃O₂

Purity: Min. 95%

Molecular weight: 299.37 g/mol

Ref: 3D-CGA27312