CymitQuimica logo

CAS 1523617-84-6

:

1-Oxa-7-azaspiro[3.5]nonane, ethanedioate (2:1)

Description:
1-Oxa-7-azaspiro[3.5]nonane, ethanedioate (2:1) is a chemical compound characterized by its unique spirocyclic structure, which incorporates both oxygen and nitrogen atoms within a bicyclic framework. The presence of the oxo and azaspiro moieties contributes to its potential biological activity and interaction with various receptors or enzymes. The ethanedioate component indicates that the compound forms a salt or complex with oxalic acid, which may influence its solubility and stability in different environments. This compound is likely to exhibit properties typical of spiro compounds, such as rigidity and a constrained conformation, which can affect its reactivity and interaction with other molecules. Additionally, the specific arrangement of atoms and functional groups may impart unique pharmacological properties, making it of interest in medicinal chemistry. Overall, the characteristics of this compound suggest potential applications in drug development or as a chemical probe in biological research, although further studies would be necessary to elucidate its specific properties and functions.
Formula:C16H28N2O6
InChI:InChI=1S/C7H13NO.C2H2O4/c1-4-8-5-2-7(1)3-6-9-7;3-1(4)2(5)6/h8H,1-6H2;(H,3,4)(H,5,6)
InChI key:InChIKey=XMCQWXRRRJGCDN-UHFFFAOYSA-N
SMILES:C12(CCO1)CCNCC2.C(C(O)=O)(O)=O
Synonyms:
  • 1-Oxa-7-azaspiro[3.5]nonane oxalate(2:1)
  • Bis(1-oxa-7-azaspiro[3.5]nonane); oxalic acid
  • 1-Oxa-7-azaspiro[3.5]nonane, ethanedioate (2:1)
  • 1-Oxa-7-azaspiro[3.5]nonane hemioxalate - O7366
Found 4 products.