CymitQuimica logo

CAS 1529613-64-6

:

Methyl 3-amino-4-bromo-2,6-difluorobenzoate

Description:
Methyl 3-amino-4-bromo-2,6-difluorobenzoate is an organic compound characterized by its complex structure, which includes a benzoate moiety substituted with various functional groups. The presence of the amino group (-NH2) indicates potential for hydrogen bonding and reactivity, while the bromo (-Br) and difluoro (-F) substituents contribute to its electrophilic properties and influence its reactivity in nucleophilic substitution reactions. This compound is likely to exhibit moderate polarity due to the presence of both polar and nonpolar groups, affecting its solubility in different solvents. The fluorine atoms can enhance the compound's stability and lipophilicity, making it of interest in medicinal chemistry and material science. Additionally, the specific arrangement of substituents on the benzene ring can lead to unique electronic properties, which may be exploited in various applications, including pharmaceuticals and agrochemicals. Overall, Methyl 3-amino-4-bromo-2,6-difluorobenzoate is a versatile compound with potential utility in synthetic chemistry and drug development.
Formula:C8H6BrF2NO2
InChI:InChI=1S/C8H6BrF2NO2/c1-14-8(13)5-4(10)2-3(9)7(12)6(5)11/h2H,12H2,1H3
InChI key:NGLQFAWDCRSRSN-UHFFFAOYSA-N
SMILES:COC(=O)C1=C(C(=C(C=C1F)Br)N)F
Found 5 products.