CymitQuimica logo

CAS 153200-73-8

:

1,4-phenylenediamine-D8

Description:
1,4-Phenylenediamine-D8, with the CAS number 153200-73-8, is a deuterated form of 1,4-phenylenediamine, which is an aromatic amine. This compound features a benzene ring with two amino groups (-NH2) positioned at the para (1,4) positions. The "D8" designation indicates that the hydrogen atoms in the amino groups have been replaced with deuterium, a stable isotope of hydrogen, which is often used in NMR spectroscopy and other analytical techniques to study molecular structures and dynamics. 1,4-Phenylenediamine-D8 is typically utilized in research applications, particularly in the fields of organic chemistry and materials science. Its properties include being a solid at room temperature, with potential solubility in polar solvents. The presence of amino groups makes it a versatile compound for various chemical reactions, including polymerization and dye synthesis. Safety considerations are important, as 1,4-phenylenediamine and its derivatives can be hazardous, necessitating appropriate handling and disposal measures.
Formula:C6H8N2
InChI:InChI=1S/C6H8N2/c7-5-1-2-6(8)4-3-5/h1-4H,7-8H2/i1D,2D,3D,4D/hD4
InChI key:CBCKQZAAMUWICA-GCJHLHDMSA-N
SMILES:[2H]C1=C(C(=C(C(=C1N([2H])[2H])[2H])[2H])N([2H])[2H])[2H]
Found 1 products.