CAS 153277-35-1
:ANTHRAQUINONE-2-SULFONIC ACID, SODIUM SALT, MONOHYDRATE, 90
Description:
Anthraquinone-2-sulfonic acid, sodium salt, monohydrate, is a synthetic organic compound characterized by its anthraquinone structure, which features a sulfonic acid group that enhances its solubility in water. This compound typically appears as a crystalline solid and is known for its vibrant color, which can vary depending on its specific formulation and concentration. It is commonly used as a dye intermediate and in various industrial applications, including textiles and paper manufacturing. The presence of the sodium salt form allows for improved solubility and stability in aqueous solutions. Additionally, the monohydrate form indicates that the compound contains one molecule of water per formula unit, which can influence its physical properties and reactivity. Anthraquinone derivatives are often studied for their potential applications in organic electronics and as redox-active materials. Safety data should be consulted, as with any chemical, to understand its handling, storage, and potential hazards.
Formula:C14H7O5S
InChI:InChI=1/C14H8O5S/c15-13-9-3-1-2-4-10(9)14(16)12-7-8(20(17,18)19)5-6-11(12)13/h1-7H,(H,17,18,19)/p-1
SMILES:c1ccc2c(c1)C(=O)c1ccc(cc1C2=O)S(=O)(=O)[O-]
Synonyms:- 9,10-Dihydro-9,10-dioxo-2-anthracenesulfonic acid sodium salt, Sodium anthraquinone-2-sulfonate
- Anthraquinone-2-sulfonic acid monohydrate sodium salt
- 9,10-Dioxo-9,10-Dihydroanthracene-2-Sulfonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Sodium Anthraquinone-2-sulfonate Monohydrate
CAS:Formula:C14H7NaO5S·H2OPurity:>98.0%(T)(HPLC)Color and Shape:White to Yellow to Green powder to crystalMolecular weight:328.279,10-Anthraquinone-2-sulfonic acid sodium salt hydrate, 97% (dry wt.), water ca 4-6%
CAS:9,10-Anthraquinone-2-sulfonic acid sodium salt hydrate forms charge-transfer complexes with 9,10-dimethoxyanthracene-2-sulfonate. It is used as a catalyst in production of alkaline pulping in the soda process. It is used as an in situ photochemical fluorescence probe. This Thermo Scientific ChemicalFormula:C14H7NaO5SPurity:4-6%Color and Shape:White to cream to yellow or pale brown, Powder or slightly moist powderMolecular weight:310.25Sodium 9,10-dioxo-9,10-dihydroanthracene-2-sulfonate hydrate
CAS:Formula:C14H9NaO6SPurity:97%Color and Shape:SolidMolecular weight:328.2724Sodium Anthraquinone-2-Sulfonate Monohydrate
CAS:Sodium Anthraquinone-2-Sulfonate MonohydrateFormula:C14H9NaO6SPurity:97%Color and Shape:SolidMolecular weight:328.27Sodium 9,10-dioxo-9,10-dihydroanthracene-2-sulfonate hydrate
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:328.2699890136719Anthraquinone-2-sulfonic acid sodium salt monohydrate
CAS:Anthraquinone-2-sulfonic acid sodium salt monohydrate (AQASM) is a gold nanoparticle that can be used as an effective catalyst for the oxidative degradation of ethylene diamine. AQASM has been shown to have photocatalytic activity in the presence of light and voltammetric properties. It also has linear range for chloride concentrations, with high values obtained at low concentrations. This compound is able to oxidize proteins and inorganic substances, such as sodium carbonate and sodium nitrate. The functional groups are responsible for the electrochemical properties of this compound. The energy efficiency of AQASM makes it an attractive alternative to other catalysts, such as palladium or platinum.
Formula:C14H9NaO6SPurity:Min. 95%Color and Shape:White PowderMolecular weight:328.27 g/mol





